C17H24Cl2FNO — CID 71251723
(3,5-dichloro-3-fluorocyclohexa-1,4-dien-1-yl)-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone (PubChem CID 71251723) has the molecular formula C17H24Cl2FNO and a molecular weight of 348.29 g/mol. Its IUPAC name is (3,5-dichloro-3-fluorocyclohexa-1,4-dien-1-yl)-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone.
| Compound Name | (3,5-dichloro-3-fluorocyclohexa-1,4-dien-1-yl)-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 71251723 |
| Molecular Formula | C17H24Cl2FNO |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (3,5-dichloro-3-fluorocyclohexa-1,4-dien-1-yl)-[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]methanone |
| SMILES | CC(C)(C)CCC1(C(=O)C2=CC(F)(Cl)C=C(Cl)C2)CCNC1 |
| InChI | InChI=1S/C17H24Cl2FNO/c1-15(2,3)4-5-16(6-7-21-11-16)14(22)12-8-13(18)10-17(19,20)9-12/h9-10,21H,4-8,11H2,1-3H3 |
| InChIKey | JJLKUYNYNMWXKL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|