C24H24F5N5O — CID 71252811
(3R)-4-(3,4-difluorophenyl)-3-[[(1R)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one (PubChem CID 71252811) has the molecular formula C24H24F5N5O and a molecular weight of 493.48 g/mol. Its IUPAC name is (3R)-4-(3,4-difluorophenyl)-3-[[(1R)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one.
| Compound Name | (3R)-4-(3,4-difluorophenyl)-3-[[(1R)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one |
|---|---|
| PubChem CID | 71252811 |
| Molecular Formula | C24H24F5N5O |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (3R)-4-(3,4-difluorophenyl)-3-[[(1R)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-1-one |
| SMILES | C[C@@H](N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24F5N5O/c1-15(17-5-3-2-4-6-17)30-18(11-16-7-8-19(25)20(26)12-16)13-22(35)33-9-10-34-21(14-33)31-32-23(34)24(27,28)29/h2-8,12,15,18,30H,9-11,13-14H2,1H3/t15-,18-/m1/s1 |
| InChIKey | RSPQDCIMWWCJCH-CRAIPNDOSA-N |
| XLogP | 4.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |