About (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid
(3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid (PubChem CID 71252823) has the molecular formula C8H12F3N3O3
and a molecular weight of 255.20 g/mol. Its IUPAC name is (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid |
| PubChem CID | 71252823 |
| Molecular Formula | C8H12F3N3O3 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid |
| SMILES | O=C(NCC(F)(F)F)[C@H]1CN(C(=O)O)CCN1 |
| InChI | InChI=1S/C8H12F3N3O3/c9-8(10,11)4-13-6(15)5-3-14(7(16)17)2-1-12-5/h5,12H,1-4H2,(H,13,15)(H,16,17)/t5-/m1/s1 |
| InChIKey | ONRZXZMOSULFAC-RXMQYKEDSA-N |
| XLogP | -0.38 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid?
The IUPAC name of (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid (CID 71252823) is (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid.
What is the SMILES notation for (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid?
The canonical SMILES for (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid is O=C(NCC(F)(F)F)[C@H]1CN(C(=O)O)CCN1.
What is the InChIKey of (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid?
The InChIKey is ONRZXZMOSULFAC-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H12F3N3O3/c9-8(10,11)4-13-6(15)5-3-14(7(16)17)2-1-12-5/h5,12H,1-4H2,(H,13,15)(H,16,17)/t5-/m1/s1.
What are the key properties of (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid?
(3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid has a molecular weight of 255.20 g/mol, XLogP of -0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylic acid is sourced from PubChem (CID 71252823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).