C32H42ClN7O3Si — CID 71253367
tert-butyl N-[1-[3-chloro-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-4-yl]carbamate (PubChem CID 71253367) has the molecular formula C32H42ClN7O3Si and a molecular weight of 636.27 g/mol. Its IUPAC name is tert-butyl N-[1-[3-chloro-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-chloro-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71253367 |
| Molecular Formula | C32H42ClN7O3Si |
| Molecular Weight | 636.27 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | tert-butyl N-[1-[3-chloro-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2nc(-c3nn(COCC[Si](C)(C)C)c4cnc(-c5cccnc5)cc34)ccc2Cl)CC1 |
| InChI | InChI=1S/C32H42ClN7O3Si/c1-32(2,3)43-31(41)36-23-11-14-39(15-12-23)30-25(33)9-10-26(37-30)29-24-18-27(22-8-7-13-34-19-22)35-20-28(24)40(38-29)21-42-16-17-44(4,5)6/h7-10,13,18-20,23H,11-12,14-17,21H2,1-6H3,(H,36,41) |
| InChIKey | HDTWDYNYMLTPJT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.27 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|