C21H17F2N5O — CID 71253531
5-(5-fluoro-3-pyridinyl)-3-(6-fluoro-2-pyridinyl)-1-(oxan-2-yl)pyrazolo[3,4-c]pyridine (PubChem CID 71253531) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is 5-(5-fluoro-3-pyridinyl)-3-(6-fluoro-2-pyridinyl)-1-(oxan-2-yl)pyrazolo[3,4-c]pyridine.
| Compound Name | 5-(5-fluoro-3-pyridinyl)-3-(6-fluoro-2-pyridinyl)-1-(oxan-2-yl)pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 71253531 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-(5-fluoro-3-pyridinyl)-3-(6-fluoro-2-pyridinyl)-1-(oxan-2-yl)pyrazolo[3,4-c]pyridine |
| SMILES | Fc1cncc(-c2cc3c(-c4cccc(F)n4)nn(C4CCCCO4)c3cn2)c1 |
| InChI | InChI=1S/C21H17F2N5O/c22-14-8-13(10-24-11-14)17-9-15-18(12-25-17)28(20-6-1-2-7-29-20)27-21(15)16-4-3-5-19(23)26-16/h3-5,8-12,20H,1-2,6-7H2 |
| InChIKey | MLSATNKRYBIJAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|