C34H47N7O3Si — CID 71253627
tert-butyl N-[(3S)-1-[3-ethyl-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 71253627) has the molecular formula C34H47N7O3Si and a molecular weight of 629.88 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[3-ethyl-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[3-ethyl-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71253627 |
| Molecular Formula | C34H47N7O3Si |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | tert-butyl N-[(3S)-1-[3-ethyl-6-[5-pyridin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-2-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CCc1ccc(-c2nn(COCC[Si](C)(C)C)c3cnc(-c4cccnc4)cc23)nc1N1CCC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C34H47N7O3Si/c1-8-24-13-14-28(38-32(24)40-16-10-12-26(22-40)37-33(42)44-34(2,3)4)31-27-19-29(25-11-9-15-35-20-25)36-21-30(27)41(39-31)23-43-17-18-45(5,6)7/h9,11,13-15,19-21,26H,8,10,12,16-18,22-23H2,1-7H3,(H,37,42)/t26-/m0/s1 |
| InChIKey | ZCDYDAVDKZQQDN-SANMLTNESA-N |
| XLogP | 6.92 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|