About 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine
3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine (PubChem CID 71253637) has the molecular formula C17H14FN5O
and a molecular weight of 323.33 g/mol. Its IUPAC name is 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine |
| PubChem CID | 71253637 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine |
| SMILES | COc1ccc(F)c(-c2n[nH]c3cnc(-c4cnn(C)c4)cc23)c1 |
| InChI | InChI=1S/C17H14FN5O/c1-23-9-10(7-20-23)15-6-13-16(8-19-15)21-22-17(13)12-5-11(24-2)3-4-14(12)18/h3-9H,1-2H3,(H,21,22) |
| InChIKey | HKDNCYDMZJZYGM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine (CID 71253637) is 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine is COc1ccc(F)c(-c2n[nH]c3cnc(-c4cnn(C)c4)cc23)c1.
What is the InChIKey of 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine?
The InChIKey is HKDNCYDMZJZYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN5O/c1-23-9-10(7-20-23)15-6-13-16(8-19-15)21-22-17(13)12-5-11(24-2)3-4-14(12)18/h3-9H,1-2H3,(H,21,22).
What are the key properties of 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine?
3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine has a molecular weight of 323.33 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluoro-5-methoxyphenyl)-5-(1-methylpyrazol-4-yl)-1H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 71253637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).