About 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine
5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine (PubChem CID 71254005) has the molecular formula C20H24N6O
and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine |
| PubChem CID | 71254005 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine |
| SMILES | c1cc(-c2n[nH]c3cnc(C4CCCOC4)cc23)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C20H24N6O/c1-4-16(23-19(5-1)26-8-6-21-7-9-26)20-15-11-17(14-3-2-10-27-13-14)22-12-18(15)24-25-20/h1,4-5,11-12,14,21H,2-3,6-10,13H2,(H,24,25) |
| InChIKey | QKRLKEOSBXNMGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine (CID 71254005) is 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine is c1cc(-c2n[nH]c3cnc(C4CCCOC4)cc23)nc(N2CCNCC2)c1.
What is the InChIKey of 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine?
The InChIKey is QKRLKEOSBXNMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O/c1-4-16(23-19(5-1)26-8-6-21-7-9-26)20-15-11-17(14-3-2-10-27-13-14)22-12-18(15)24-25-20/h1,4-5,11-12,14,21H,2-3,6-10,13H2,(H,24,25).
What are the key properties of 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine?
5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine has a molecular weight of 364.45 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-3-yl)-3-(6-piperazin-1-yl-2-pyridinyl)-1H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 71254005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).