C23H28N4S — CID 71254446
2-[6-methyl-4-(2,3,4,5-tetrahydro-1,2-benzothiazepin-4-yl)-1H-quinolin-4-yl]pyrrolidin-3-amine (PubChem CID 71254446) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[6-methyl-4-(2,3,4,5-tetrahydro-1,2-benzothiazepin-4-yl)-1H-quinolin-4-yl]pyrrolidin-3-amine.
| Compound Name | 2-[6-methyl-4-(2,3,4,5-tetrahydro-1,2-benzothiazepin-4-yl)-1H-quinolin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 71254446 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[6-methyl-4-(2,3,4,5-tetrahydro-1,2-benzothiazepin-4-yl)-1H-quinolin-4-yl]pyrrolidin-3-amine |
| SMILES | Cc1ccc2c(c1)C(C1CNSc3ccccc3C1)(C1NCCC1N)C=CN2 |
| InChI | InChI=1S/C23H28N4S/c1-15-6-7-20-18(12-15)23(9-11-25-20,22-19(24)8-10-26-22)17-13-16-4-2-3-5-21(16)28-27-14-17/h2-7,9,11-12,17,19,22,25-27H,8,10,13-14,24H2,1H3 |
| InChIKey | BYFSAZXKHVJINZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|