About 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide
4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide (PubChem CID 71254515) has the molecular formula C19H18ClN3OS
and a molecular weight of 371.89 g/mol. Its IUPAC name is 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide.
Molecular Properties
| Compound Name | 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide |
| PubChem CID | 71254515 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide |
| SMILES | [H]N=S1(=O)CCN(c2cc(Cl)c3cc(C)ccc3n2)Cc2ccccc21 |
| InChI | InChI=1S/C19H18ClN3OS/c1-13-6-7-17-15(10-13)16(20)11-19(22-17)23-8-9-25(21,24)18-5-3-2-4-14(18)12-23/h2-7,10-11,21H,8-9,12H2,1H3 |
| InChIKey | UKWIEPBRDFKWJD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide?
The IUPAC name of 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide (CID 71254515) is 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide.
What is the SMILES notation for 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide?
The canonical SMILES for 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide is [H]N=S1(=O)CCN(c2cc(Cl)c3cc(C)ccc3n2)Cc2ccccc21.
What is the InChIKey of 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide?
The InChIKey is UKWIEPBRDFKWJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3OS/c1-13-6-7-17-15(10-13)16(20)11-19(22-17)23-8-9-25(21,24)18-5-3-2-4-14(18)12-23/h2-7,10-11,21H,8-9,12H2,1H3.
What are the key properties of 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide?
4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide has a molecular weight of 371.89 g/mol, XLogP of 4.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-6-methylquinolin-2-yl)-1-imino-3,5-dihydro-2H-1λ6,4-benzothiazepine 1-oxide is sourced from PubChem (CID 71254515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).