C21H24N4O3S — CID 71254541
4-[4-(3-aminopropylamino)-6-hydroxyquinolin-2-yl]-3,5-dihydro-2H-1,4-benzothiazepine-2,3-diol (PubChem CID 71254541) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-[4-(3-aminopropylamino)-6-hydroxyquinolin-2-yl]-3,5-dihydro-2H-1,4-benzothiazepine-2,3-diol.
| Compound Name | 4-[4-(3-aminopropylamino)-6-hydroxyquinolin-2-yl]-3,5-dihydro-2H-1,4-benzothiazepine-2,3-diol |
|---|---|
| PubChem CID | 71254541 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-[4-(3-aminopropylamino)-6-hydroxyquinolin-2-yl]-3,5-dihydro-2H-1,4-benzothiazepine-2,3-diol |
| SMILES | NCCCNc1cc(N2Cc3ccccc3SC(O)C2O)nc2ccc(O)cc12 |
| InChI | InChI=1S/C21H24N4O3S/c22-8-3-9-23-17-11-19(24-16-7-6-14(26)10-15(16)17)25-12-13-4-1-2-5-18(13)29-21(28)20(25)27/h1-2,4-7,10-11,20-21,26-28H,3,8-9,12,22H2,(H,23,24) |
| InChIKey | FIYNWDFYVZAYLF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|