C24H30N4O2S — CID 71255029
N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]pentane-1,5-diamine (PubChem CID 71255029) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]pentane-1,5-diamine.
| Compound Name | N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 71255029 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]pentane-1,5-diamine |
| SMILES | Cc1ccc2nc(N3CCS(=O)(=O)c4ccccc4C3)cc(NCCCCCN)c2c1 |
| InChI | InChI=1S/C24H30N4O2S/c1-18-9-10-21-20(15-18)22(26-12-6-2-5-11-25)16-24(27-21)28-13-14-31(29,30)23-8-4-3-7-19(23)17-28/h3-4,7-10,15-16H,2,5-6,11-14,17,25H2,1H3,(H,26,27) |
| InChIKey | LBLMPSYNGMTEEK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|