C23H28N4O3S — CID 71255183
N-[2-(2-aminoethoxy)ethyl]-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-amine (PubChem CID 71255183) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-amine |
|---|---|
| PubChem CID | 71255183 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-amine |
| SMILES | Cc1ccc2nc(N3CCS(=O)(=O)c4ccccc4C3)cc(NCCOCCN)c2c1 |
| InChI | InChI=1S/C23H28N4O3S/c1-17-6-7-20-19(14-17)21(25-9-12-30-11-8-24)15-23(26-20)27-10-13-31(28,29)22-5-3-2-4-18(22)16-27/h2-7,14-15H,8-13,16,24H2,1H3,(H,25,26) |
| InChIKey | CFMLSGOYKOTIOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|