C22H20N2O2 — CID 71255278
3-[2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)quinolin-4-yl]prop-2-enoic acid (PubChem CID 71255278) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)quinolin-4-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)quinolin-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71255278 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)quinolin-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(N2CCCc3ccccc3C2)nc2ccccc12 |
| InChI | InChI=1S/C22H20N2O2/c25-22(26)12-11-17-14-21(23-20-10-4-3-9-19(17)20)24-13-5-8-16-6-1-2-7-18(16)15-24/h1-4,6-7,9-12,14H,5,8,13,15H2,(H,25,26) |
| InChIKey | XEWYVYWEYNIEKX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|