C23H26F2N4 — CID 71255349
N'-[2-(5,5-difluoro-3,4-dihydro-1H-2-benzazepin-2-yl)-6-methylquinolin-4-yl]-N-methylethane-1,2-diamine (PubChem CID 71255349) has the molecular formula C23H26F2N4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N'-[2-(5,5-difluoro-3,4-dihydro-1H-2-benzazepin-2-yl)-6-methylquinolin-4-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-(5,5-difluoro-3,4-dihydro-1H-2-benzazepin-2-yl)-6-methylquinolin-4-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 71255349 |
| Molecular Formula | C23H26F2N4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N'-[2-(5,5-difluoro-3,4-dihydro-1H-2-benzazepin-2-yl)-6-methylquinolin-4-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1cc(N2CCC(F)(F)c3ccccc3C2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C23H26F2N4/c1-16-7-8-20-18(13-16)21(27-11-10-26-2)14-22(28-20)29-12-9-23(24,25)19-6-4-3-5-17(19)15-29/h3-8,13-14,26H,9-12,15H2,1-2H3,(H,27,28) |
| InChIKey | LFAHSUMJDRICJW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|