C19H18N2O2S2 — CID 71255380
2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methyl-1H-quinoline-4-thione (PubChem CID 71255380) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methyl-1H-quinoline-4-thione.
| Compound Name | 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methyl-1H-quinoline-4-thione |
|---|---|
| PubChem CID | 71255380 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methyl-1H-quinoline-4-thione |
| SMILES | Cc1ccc2[nH]c(N3CCS(=O)(=O)c4ccccc4C3)cc(=S)c2c1 |
| InChI | InChI=1S/C19H18N2O2S2/c1-13-6-7-16-15(10-13)17(24)11-19(20-16)21-8-9-25(22,23)18-5-3-2-4-14(18)12-21/h2-7,10-11H,8-9,12H2,1H3,(H,20,24) |
| InChIKey | GTHLKXUOHNYRJM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|