C22H26F2N4O2S — CID 71255802
N'-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]-2,2-difluoropropane-1,3-diamine (PubChem CID 71255802) has the molecular formula C22H26F2N4O2S and a molecular weight of 448.54 g/mol. Its IUPAC name is N'-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]-2,2-difluoropropane-1,3-diamine.
| Compound Name | N'-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]-2,2-difluoropropane-1,3-diamine |
|---|---|
| PubChem CID | 71255802 |
| Molecular Formula | C22H26F2N4O2S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N'-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]-2,2-difluoropropane-1,3-diamine |
| SMILES | Cc1ccc2nc(N3CCS(O)(O)c4ccccc4C3)cc(NCC(F)(F)CN)c2c1 |
| InChI | InChI=1S/C22H26F2N4O2S/c1-15-6-7-18-17(10-15)19(26-14-22(23,24)13-25)11-21(27-18)28-8-9-31(29,30)20-5-3-2-4-16(20)12-28/h2-7,10-11,29-30H,8-9,12-14,25H2,1H3,(H,26,27) |
| InChIKey | CMVQPUZPWXDVEF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |