C16H17N3O2S — CID 71255898
tert-butyl 2-amino-4-(1H-benzimidazol-2-yl)thiophene-3-carboxylate (PubChem CID 71255898) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(1H-benzimidazol-2-yl)thiophene-3-carboxylate.
| Compound Name | tert-butyl 2-amino-4-(1H-benzimidazol-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 71255898 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl 2-amino-4-(1H-benzimidazol-2-yl)thiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(-c2nc3ccccc3[nH]2)csc1N |
| InChI | InChI=1S/C16H17N3O2S/c1-16(2,3)21-15(20)12-9(8-22-13(12)17)14-18-10-6-4-5-7-11(10)19-14/h4-8H,17H2,1-3H3,(H,18,19) |
| InChIKey | URIKUDSOZAEJHY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |