C31H24F3N9OS — CID 71255951
2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]-6-(2-pyrimidin-5-ylphenyl)-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 71255951) has the molecular formula C31H24F3N9OS and a molecular weight of 627.66 g/mol. Its IUPAC name is 2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]-6-(2-pyrimidin-5-ylphenyl)-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]-6-(2-pyrimidin-5-ylphenyl)-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71255951 |
| Molecular Formula | C31H24F3N9OS |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 2-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]-6-(2-pyrimidin-5-ylphenyl)-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1c(-c2ccccc2-c2cncnc2)cc2cnc(Nc3ccc(N4CCNCC4)c(C(F)(F)F)c3)nc2n1-c1nccs1 |
| InChI | InChI=1S/C31H24F3N9OS/c32-31(33,34)25-14-21(5-6-26(25)42-10-7-35-8-11-42)40-29-39-17-19-13-24(28(44)43(27(19)41-29)30-38-9-12-45-30)23-4-2-1-3-22(23)20-15-36-18-37-16-20/h1-6,9,12-18,35H,7-8,10-11H2,(H,39,40,41) |
| InChIKey | MONSKIAEZPAGMV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|