C23H22BrF3N4O4 — CID 71256211
N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-methoxy-2-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 71256211) has the molecular formula C23H22BrF3N4O4 and a molecular weight of 555.35 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-methoxy-2-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-methoxy-2-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 71256211 |
| Molecular Formula | C23H22BrF3N4O4 |
| Molecular Weight | 555.35 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-methoxy-2-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | COc1cc(C=NN(CC(F)(F)F)C(=O)C(OC)c2ccc(-n3cccn3)cc2)cc(OC)c1Br |
| InChI | InChI=1S/C23H22BrF3N4O4/c1-33-18-11-15(12-19(34-2)20(18)24)13-29-31(14-23(25,26)27)22(32)21(35-3)16-5-7-17(8-6-16)30-10-4-9-28-30/h4-13,21H,14H2,1-3H3 |
| InChIKey | TWFZSSQKOXBZON-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|