About N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine
N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine (PubChem CID 71256298) has the molecular formula C20H16ClN3O
and a molecular weight of 349.82 g/mol. Its IUPAC name is N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine |
| PubChem CID | 71256298 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine |
| SMILES | CN(Cc1ccccc1)c1ccc2nc(-c3cccc(Cl)c3)oc2n1 |
| InChI | InChI=1S/C20H16ClN3O/c1-24(13-14-6-3-2-4-7-14)18-11-10-17-20(23-18)25-19(22-17)15-8-5-9-16(21)12-15/h2-12H,13H2,1H3 |
| InChIKey | FOIHFZFCWPDSTI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine?
The IUPAC name of N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine (CID 71256298) is N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine.
What is the SMILES notation for N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine?
The canonical SMILES for N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine is CN(Cc1ccccc1)c1ccc2nc(-c3cccc(Cl)c3)oc2n1.
What is the InChIKey of N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine?
The InChIKey is FOIHFZFCWPDSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O/c1-24(13-14-6-3-2-4-7-14)18-11-10-17-20(23-18)25-19(22-17)15-8-5-9-16(21)12-15/h2-12H,13H2,1H3.
What are the key properties of N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine?
N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine has a molecular weight of 349.82 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(3-chlorophenyl)-N-methyl-[1,3]oxazolo[5,4-b]pyridin-5-amine is sourced from PubChem (CID 71256298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).