C23H23ClN6O2 — CID 71256360
N-[3-(4-chlorophenyl)-2-oxo-1,3-diazinan-1-yl]-3-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enamide (PubChem CID 71256360) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-2-oxo-1,3-diazinan-1-yl]-3-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enamide.
| Compound Name | N-[3-(4-chlorophenyl)-2-oxo-1,3-diazinan-1-yl]-3-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 71256360 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[3-(4-chlorophenyl)-2-oxo-1,3-diazinan-1-yl]-3-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enamide |
| SMILES | Cc1cn(-c2ccc(C=CC(=O)NN3CCCN(c4ccc(Cl)cc4)C3=O)nc2C)cn1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-16-14-28(15-25-16)21-10-6-19(26-17(21)2)7-11-22(31)27-30-13-3-12-29(23(30)32)20-8-4-18(24)5-9-20/h4-11,14-15H,3,12-13H2,1-2H3,(H,27,31) |
| InChIKey | TYIBPOYWWRRZDI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|