About 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea
1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea (PubChem CID 712567) has the molecular formula C19H27N3O
and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea |
| PubChem CID | 712567 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea |
| SMILES | Cc1ccc2[nH]c(C)c(CCNC(=O)NC3CCCCC3)c2c1 |
| InChI | InChI=1S/C19H27N3O/c1-13-8-9-18-17(12-13)16(14(2)21-18)10-11-20-19(23)22-15-6-4-3-5-7-15/h8-9,12,15,21H,3-7,10-11H2,1-2H3,(H2,20,22,23) |
| InChIKey | GJTHRSSUOHKEAN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea?
The IUPAC name of 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea (CID 712567) is 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea.
What is the SMILES notation for 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea?
The canonical SMILES for 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea is Cc1ccc2[nH]c(C)c(CCNC(=O)NC3CCCCC3)c2c1.
What is the InChIKey of 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea?
The InChIKey is GJTHRSSUOHKEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O/c1-13-8-9-18-17(12-13)16(14(2)21-18)10-11-20-19(23)22-15-6-4-3-5-7-15/h8-9,12,15,21H,3-7,10-11H2,1-2H3,(H2,20,22,23).
What are the key properties of 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea?
1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea has a molecular weight of 313.44 g/mol, XLogP of 3.96, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]urea is sourced from PubChem (CID 712567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).