C17H19F3N2O7 — CID 71257269
2-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]-2-methylpropanedioic acid (PubChem CID 71257269) has the molecular formula C17H19F3N2O7 and a molecular weight of 420.34 g/mol. Its IUPAC name is 2-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]-2-methylpropanedioic acid.
| Compound Name | 2-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 71257269 |
| Molecular Formula | C17H19F3N2O7 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]-2-methylpropanedioic acid |
| SMILES | CC(C(=O)O)(C(=O)O)c1cc(OC2CCC3(CC2)OCCO3)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H19F3N2O7/c1-15(13(23)24,14(25)26)10-8-11(22-12(21-10)17(18,19)20)29-9-2-4-16(5-3-9)27-6-7-28-16/h8-9H,2-7H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | VALHJMKFBYGYAT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|