C12H12N4O4 — CID 71257280
5-methyl-1H-pyrimidine-2,4-dione;5-prop-1-ynyl-1H-pyrimidine-2,4-dione (PubChem CID 71257280) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-methyl-1H-pyrimidine-2,4-dione;5-prop-1-ynyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1H-pyrimidine-2,4-dione;5-prop-1-ynyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71257280 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione;5-prop-1-ynyl-1H-pyrimidine-2,4-dione |
| SMILES | CC#Cc1c[nH]c(=O)[nH]c1=O.Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H6N2O2.C5H6N2O2/c1-2-3-5-4-8-7(11)9-6(5)10;1-3-2-6-5(9)7-4(3)8/h4H,1H3,(H2,8,9,10,11);2H,1H3,(H2,6,7,8,9) |
| InChIKey | KJXPKRDHQWTCLS-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|