C27H34N6OSi — CID 71258462
4-[[4-[10-(2-trimethylsilylethoxymethyl)-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 71258462) has the molecular formula C27H34N6OSi and a molecular weight of 486.70 g/mol. Its IUPAC name is 4-[[4-[10-(2-trimethylsilylethoxymethyl)-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[10-(2-trimethylsilylethoxymethyl)-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 71258462 |
| Molecular Formula | C27H34N6OSi |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 4-[[4-[10-(2-trimethylsilylethoxymethyl)-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncn1cnc(C3CCN(Cc4ccc(C#N)cc4)CC3)c21 |
| InChI | InChI=1S/C27H34N6OSi/c1-35(2,3)15-14-34-20-32-13-10-24-26-25(29-18-33(26)19-30-27(24)32)23-8-11-31(12-9-23)17-22-6-4-21(16-28)5-7-22/h4-7,10,13,18-19,23H,8-9,11-12,14-15,17,20H2,1-3H3 |
| InChIKey | JNIVXPIVDBVZJG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|