C17H27ClN2O2SSi — CID 71258463
(4-chloro-5-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (PubChem CID 71258463) has the molecular formula C17H27ClN2O2SSi and a molecular weight of 387.02 g/mol. Its IUPAC name is (4-chloro-5-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane.
| Compound Name | (4-chloro-5-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 71258463 |
| Molecular Formula | C17H27ClN2O2SSi |
| Molecular Weight | 387.02 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (4-chloro-5-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(Cl)c(S(C)(=O)=O)cnc21 |
| InChI | InChI=1S/C17H27ClN2O2SSi/c1-11(2)24(12(3)4,13(5)6)20-9-8-14-16(18)15(23(7,21)22)10-19-17(14)20/h8-13H,1-7H3 |
| InChIKey | UKVGMCWFXCRNSC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.02 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|