C27H33ClF3NO3 — CID 71258499
(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol;hydrochloride (PubChem CID 71258499) has the molecular formula C27H33ClF3NO3 and a molecular weight of 512.01 g/mol. Its IUPAC name is (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol;hydrochloride.
| Compound Name | (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol;hydrochloride |
|---|---|
| PubChem CID | 71258499 |
| Molecular Formula | C27H33ClF3NO3 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol;hydrochloride |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCOCC1)[C@@H](O)CC(C)(C)C2.Cl |
| InChI | InChI=1S/C27H32F3NO3.ClH/c1-15(2)23-21-22(20-18(31-23)13-25(3,4)14-19(20)32)26(9-11-33-12-10-26)34-24(21)16-5-7-17(8-6-16)27(28,29)30;/h5-8,15,19,24,32H,9-14H2,1-4H3;1H/t19-,24+;/m0./s1 |
| InChIKey | FFHPTAQRXDVLDC-BROMNNCMSA-N |
| XLogP | 6.78 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |