C20H19N5O2S2 — CID 71259221
1-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide (PubChem CID 71259221) has the molecular formula C20H19N5O2S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 1-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide.
| Compound Name | 1-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide |
|---|---|
| PubChem CID | 71259221 |
| Molecular Formula | C20H19N5O2S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide |
| SMILES | Cn1cc(-c2cccc3c2CNCC3)c2ccc(S(=O)(=O)Nc3ncns3)cc21 |
| InChI | InChI=1S/C20H19N5O2S2/c1-25-11-18(15-4-2-3-13-7-8-21-10-17(13)15)16-6-5-14(9-19(16)25)29(26,27)24-20-22-12-23-28-20/h2-6,9,11-12,21H,7-8,10H2,1H3,(H,22,23,24) |
| InChIKey | WLHJAUMZXRWNNH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |