About 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole
3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole (PubChem CID 71259253) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole |
| PubChem CID | 71259253 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole |
| SMILES | C1CN(c2nc(C3CCOCC3)ns2)CCN1 |
| InChI | InChI=1S/C11H18N4OS/c1-7-16-8-2-9(1)10-13-11(17-14-10)15-5-3-12-4-6-15/h9,12H,1-8H2 |
| InChIKey | AIRDIQXEQVDWBY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole?
The IUPAC name of 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole (CID 71259253) is 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole.
What is the SMILES notation for 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole?
The canonical SMILES for 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole is C1CN(c2nc(C3CCOCC3)ns2)CCN1.
What is the InChIKey of 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole?
The InChIKey is AIRDIQXEQVDWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-7-16-8-2-9(1)10-13-11(17-14-10)15-5-3-12-4-6-15/h9,12H,1-8H2.
What are the key properties of 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole?
3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole has a molecular weight of 254.36 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-yl)-5-piperazin-1-yl-1,2,4-thiadiazole is sourced from PubChem (CID 71259253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).