C23H20F3N5O2S2 — CID 71259363
1-methyl-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide (PubChem CID 71259363) has the molecular formula C23H20F3N5O2S2 and a molecular weight of 519.57 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide.
| Compound Name | 1-methyl-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide |
|---|---|
| PubChem CID | 71259363 |
| Molecular Formula | C23H20F3N5O2S2 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-methyl-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-N-(1,2,4-thiadiazol-5-yl)indole-6-sulfonamide |
| SMILES | Cn1cc(-c2ccc(C(F)(F)F)cc2C2=CCNCC2)c2ccc(S(=O)(=O)Nc3ncns3)cc21 |
| InChI | InChI=1S/C23H20F3N5O2S2/c1-31-12-20(17-4-2-15(23(24,25)26)10-19(17)14-6-8-27-9-7-14)18-5-3-16(11-21(18)31)35(32,33)30-22-28-13-29-34-22/h2-6,10-13,27H,7-9H2,1H3,(H,28,29,30) |
| InChIKey | OIKCTIPDHMRZCY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |