C27H33FN6O3 — CID 71259438
N-[2-[(3-cyano-4-fluorophenyl)carbamoylamino]-1-(3-ethoxypropyl)benzimidazol-5-yl]-N,3,3-trimethylbutanamide (PubChem CID 71259438) has the molecular formula C27H33FN6O3 and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[2-[(3-cyano-4-fluorophenyl)carbamoylamino]-1-(3-ethoxypropyl)benzimidazol-5-yl]-N,3,3-trimethylbutanamide.
| Compound Name | N-[2-[(3-cyano-4-fluorophenyl)carbamoylamino]-1-(3-ethoxypropyl)benzimidazol-5-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 71259438 |
| Molecular Formula | C27H33FN6O3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-[2-[(3-cyano-4-fluorophenyl)carbamoylamino]-1-(3-ethoxypropyl)benzimidazol-5-yl]-N,3,3-trimethylbutanamide |
| SMILES | CCOCCCn1c(NC(=O)Nc2ccc(F)c(C#N)c2)nc2cc(N(C)C(=O)CC(C)(C)C)ccc21 |
| InChI | InChI=1S/C27H33FN6O3/c1-6-37-13-7-12-34-23-11-9-20(33(5)24(35)16-27(2,3)4)15-22(23)31-25(34)32-26(36)30-19-8-10-21(28)18(14-19)17-29/h8-11,14-15H,6-7,12-13,16H2,1-5H3,(H2,30,31,32,36) |
| InChIKey | RQPVAHLDLAHOLS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|