C25H18N6O — CID 71259783
N-[1-[(3-cyanophenyl)methyl]pyrazol-4-yl]-6-phenyl-1H-indazole-3-carboxamide (PubChem CID 71259783) has the molecular formula C25H18N6O and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]pyrazol-4-yl]-6-phenyl-1H-indazole-3-carboxamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]pyrazol-4-yl]-6-phenyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 71259783 |
| Molecular Formula | C25H18N6O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]pyrazol-4-yl]-6-phenyl-1H-indazole-3-carboxamide |
| SMILES | N#Cc1cccc(Cn2cc(NC(=O)c3n[nH]c4cc(-c5ccccc5)ccc34)cn2)c1 |
| InChI | InChI=1S/C25H18N6O/c26-13-17-5-4-6-18(11-17)15-31-16-21(14-27-31)28-25(32)24-22-10-9-20(12-23(22)29-30-24)19-7-2-1-3-8-19/h1-12,14,16H,15H2,(H,28,32)(H,29,30) |
| InChIKey | QARHDYJSZZBQPY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |