C22H22N4OS — CID 71260560
N-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-4-(thiadiazol-4-yl)benzamide (PubChem CID 71260560) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-4-(thiadiazol-4-yl)benzamide.
| Compound Name | N-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-4-(thiadiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 71260560 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-4-(thiadiazol-4-yl)benzamide |
| SMILES | O=C(Nc1ccc(C2CC2NCC2CC2)cc1)c1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C22H22N4OS/c27-22(17-5-3-16(4-6-17)21-13-28-26-25-21)24-18-9-7-15(8-10-18)19-11-20(19)23-12-14-1-2-14/h3-10,13-14,19-20,23H,1-2,11-12H2,(H,24,27) |
| InChIKey | JJHNABWFLGGONZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |