C13H26N2 — CID 71260711
7-hexyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine (PubChem CID 71260711) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 7-hexyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine.
| Compound Name | 7-hexyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71260711 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 7-hexyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
| SMILES | CCCCCCC1CCN2CCNC2C1 |
| InChI | InChI=1S/C13H26N2/c1-2-3-4-5-6-12-7-9-15-10-8-14-13(15)11-12/h12-14H,2-11H2,1H3 |
| InChIKey | FSMNDTPKXDWMHG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|