About (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide
(2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide (PubChem CID 71260975) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide.
Molecular Properties
| Compound Name | (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide |
| PubChem CID | 71260975 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide |
| SMILES | CCCNC(=O)[C@@H](CCCCn1cccc1)n1cccc1 |
| InChI | InChI=1S/C17H25N3O/c1-2-10-18-17(21)16(20-14-7-8-15-20)9-3-4-11-19-12-5-6-13-19/h5-8,12-16H,2-4,9-11H2,1H3,(H,18,21)/t16-/m1/s1 |
| InChIKey | APLYJUZQZMRADY-MRXNPFEDSA-N |
| XLogP | 3.23 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide?
The IUPAC name of (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide (CID 71260975) is (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide.
What is the SMILES notation for (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide?
The canonical SMILES for (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide is CCCNC(=O)[C@@H](CCCCn1cccc1)n1cccc1.
What is the InChIKey of (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide?
The InChIKey is APLYJUZQZMRADY-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H25N3O/c1-2-10-18-17(21)16(20-14-7-8-15-20)9-3-4-11-19-12-5-6-13-19/h5-8,12-16H,2-4,9-11H2,1H3,(H,18,21)/t16-/m1/s1.
What are the key properties of (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide?
(2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide has a molecular weight of 287.41 g/mol, XLogP of 3.23, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-propyl-2,6-di(pyrrol-1-yl)hexanamide is sourced from PubChem (CID 71260975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).