C22H24N4O2 — CID 71261688
6-[(E)-3-oxo-3-[4-(pyridin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 71261688) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[4-(pyridin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-[4-(pyridin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 71261688 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 6-[(E)-3-oxo-3-[4-(pyridin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CCC(Cc4ccccn4)CC3)cnc2N1 |
| InChI | InChI=1S/C22H24N4O2/c27-20-6-5-18-13-17(15-24-22(18)25-20)4-7-21(28)26-11-8-16(9-12-26)14-19-3-1-2-10-23-19/h1-4,7,10,13,15-16H,5-6,8-9,11-12,14H2,(H,24,25,27)/b7-4+ |
| InChIKey | PPKFPQPYFJNCOQ-QPJJXVBHSA-N |
| XLogP | 2.86 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|