C28H30N4O2 — CID 71261710
6-[(E)-3-[4-[(2-methyl-5-phenylpyrrol-1-yl)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 71261710) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 6-[(E)-3-[4-[(2-methyl-5-phenylpyrrol-1-yl)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-[4-[(2-methyl-5-phenylpyrrol-1-yl)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 71261710 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 6-[(E)-3-[4-[(2-methyl-5-phenylpyrrol-1-yl)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1ccc(-c2ccccc2)n1CC1CCN(C(=O)/C=C/c2cnc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C28H30N4O2/c1-20-7-10-25(23-5-3-2-4-6-23)32(20)19-21-13-15-31(16-14-21)27(34)12-8-22-17-24-9-11-26(33)30-28(24)29-18-22/h2-8,10,12,17-18,21H,9,11,13-16,19H2,1H3,(H,29,30,33)/b12-8+ |
| InChIKey | LMHASNMRTNSUQI-XYOKQWHBSA-N |
| XLogP | 4.70 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|