C26H26N4O2 — CID 71261711
6-[(E)-3-oxo-3-[4-(quinolin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 71261711) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[4-(quinolin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-[4-(quinolin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 71261711 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 6-[(E)-3-oxo-3-[4-(quinolin-2-ylmethyl)piperidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CCC(Cc4ccc5ccccc5n4)CC3)cnc2N1 |
| InChI | InChI=1S/C26H26N4O2/c31-24-9-7-21-15-19(17-27-26(21)29-24)5-10-25(32)30-13-11-18(12-14-30)16-22-8-6-20-3-1-2-4-23(20)28-22/h1-6,8,10,15,17-18H,7,9,11-14,16H2,(H,27,29,31)/b10-5+ |
| InChIKey | ZQTAEZFXWDQXHL-BJMVGYQFSA-N |
| XLogP | 4.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|