C20H14Cl2F3N7O — CID 71261763
1-[6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]-2,2,2-trifluoroethanone (PubChem CID 71261763) has the molecular formula C20H14Cl2F3N7O and a molecular weight of 496.28 g/mol. Its IUPAC name is 1-[6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 71261763 |
| Molecular Formula | C20H14Cl2F3N7O |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 1-[6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3ncnn23)nc1)C(F)(F)F |
| InChI | InChI=1S/C20H14Cl2F3N7O/c21-12-2-3-13(14(22)7-12)15-8-17-29-10-30-32(17)19(31-15)27-6-5-26-16-4-1-11(9-28-16)18(33)20(23,24)25/h1-4,7-10H,5-6H2,(H,26,28)(H,27,31) |
| InChIKey | RLCIROIYNYQGTN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|