C24H44F2O7 — CID 71261934
2,2-difluoro-2-[(2R,3R,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]acetic acid (PubChem CID 71261934) has the molecular formula C24H44F2O7 and a molecular weight of 482.61 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2R,3R,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[(2R,3R,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 71261934 |
| Molecular Formula | C24H44F2O7 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 2,2-difluoro-2-[(2R,3R,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]acetic acid |
| SMILES | CCCCOC[C@H]1O[C@@H](C(F)(F)C(=O)O)[C@H](OCCCC)C(OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C24H44F2O7/c1-5-9-13-29-17-18-19(30-14-10-6-2)20(31-15-11-7-3)21(32-16-12-8-4)22(33-18)24(25,26)23(27)28/h18-22H,5-17H2,1-4H3,(H,27,28)/t18-,19+,20?,21-,22-/m1/s1 |
| InChIKey | UCCHYPGEGJTNEM-HKCXDJLESA-N |
| XLogP | 4.85 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|