About [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate
[(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate (PubChem CID 71261972) has the molecular formula C14H25O9P
and a molecular weight of 368.32 g/mol. Its IUPAC name is [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate.
Molecular Properties
| Compound Name | [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate |
| PubChem CID | 71261972 |
| Molecular Formula | C14H25O9P |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate |
| SMILES | CCOC1=C(OCC)[C@@H]([C@H](CO)OP(=O)(OCC)OCC)OC1=O |
| InChI | InChI=1S/C14H25O9P/c1-5-18-12-11(22-14(16)13(12)19-6-2)10(9-15)23-24(17,20-7-3)21-8-4/h10-11,15H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | JXQVJNMMKWOLPS-WDEREUQCSA-N |
| XLogP | 1.75 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate?
The IUPAC name of [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate (CID 71261972) is [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate.
What is the SMILES notation for [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate?
The canonical SMILES for [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate is CCOC1=C(OCC)[C@@H]([C@H](CO)OP(=O)(OCC)OCC)OC1=O.
What is the InChIKey of [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate?
The InChIKey is JXQVJNMMKWOLPS-WDEREUQCSA-N. The full InChI is InChI=1S/C14H25O9P/c1-5-18-12-11(22-14(16)13(12)19-6-2)10(9-15)23-24(17,20-7-3)21-8-4/h10-11,15H,5-9H2,1-4H3/t10-,11+/m0/s1.
What are the key properties of [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate?
[(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate has a molecular weight of 368.32 g/mol, XLogP of 1.75, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[(2R)-3,4-diethoxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] diethyl phosphate is sourced from PubChem (CID 71261972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).