C13H17NO — CID 71262155
5-(3-methoxyphenyl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 71262155) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 5-(3-methoxyphenyl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 71262155 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-(3-methoxyphenyl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | COc1cccc(C2=CCNCCC2)c1 |
| InChI | InChI=1S/C13H17NO/c1-15-13-6-2-4-12(10-13)11-5-3-8-14-9-7-11/h2,4,6-7,10,14H,3,5,8-9H2,1H3 |
| InChIKey | BJJKBHLBWKGZEG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |