C17H21NO3 — CID 71262200
3-(2,5-dimethylphenyl)-4,8-dihydroxy-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 71262200) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-4,8-dihydroxy-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(2,5-dimethylphenyl)-4,8-dihydroxy-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 71262200 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-4,8-dihydroxy-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | Cc1ccc(C)c(C2=C(O)C3(CCC(O)CC3)NC2=O)c1 |
| InChI | InChI=1S/C17H21NO3/c1-10-3-4-11(2)13(9-10)14-15(20)17(18-16(14)21)7-5-12(19)6-8-17/h3-4,9,12,19-20H,5-8H2,1-2H3,(H,18,21) |
| InChIKey | WTHFWKYIZJQFDV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |