C11H14N2O3S — CID 71262303
5-hydroxy-5-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 71262303) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-hydroxy-5-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | 5-hydroxy-5-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 71262303 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-hydroxy-5-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1CC2CC(O)(c3nccs3)CC2C1 |
| InChI | InChI=1S/C11H14N2O3S/c14-10(15)13-5-7-3-11(16,4-8(7)6-13)9-12-1-2-17-9/h1-2,7-8,16H,3-6H2,(H,14,15) |
| InChIKey | JVKQHMRRVOZRFM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |