C21H23Cl2F2N3O6 — CID 71262535
2-[4-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]butylamino]-4-hydroxybutanoic acid (PubChem CID 71262535) has the molecular formula C21H23Cl2F2N3O6 and a molecular weight of 522.33 g/mol. Its IUPAC name is 2-[4-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]butylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[4-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]butylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 71262535 |
| Molecular Formula | C21H23Cl2F2N3O6 |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 2-[4-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]butylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCCCCNC(CCO)C(=O)O)c1 |
| InChI | InChI=1S/C21H23Cl2F2N3O6/c22-13-10-26-11-14(23)18(13)28-19(30)12-3-4-16(34-21(24)25)17(9-12)33-8-2-1-6-27-15(5-7-29)20(31)32/h3-4,9-11,15,21,27,29H,1-2,5-8H2,(H,31,32)(H,26,28,30) |
| InChIKey | MRLBVOBMAVAAQH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|