C20H21Cl2F2N3O6 — CID 71262536
2-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]propylamino]-4-hydroxybutanoic acid (PubChem CID 71262536) has the molecular formula C20H21Cl2F2N3O6 and a molecular weight of 508.31 g/mol. Its IUPAC name is 2-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]propylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]propylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 71262536 |
| Molecular Formula | C20H21Cl2F2N3O6 |
| Molecular Weight | 508.31 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoyl]-2-(difluoromethoxy)phenoxy]propylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCCCNC(CCO)C(=O)O)c1 |
| InChI | InChI=1S/C20H21Cl2F2N3O6/c21-12-9-25-10-13(22)17(12)27-18(29)11-2-3-15(33-20(23)24)16(8-11)32-7-1-5-26-14(4-6-28)19(30)31/h2-3,8-10,14,20,26,28H,1,4-7H2,(H,30,31)(H,25,27,29) |
| InChIKey | DTTYAFWXCJLSCM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|