C29H30ClFN8O5 — CID 71262947
2-methoxyethyl N-[(10R,14S)-14-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 71262947) has the molecular formula C29H30ClFN8O5 and a molecular weight of 625.06 g/mol. Its IUPAC name is 2-methoxyethyl N-[(10R,14S)-14-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[(10R,14S)-14-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 71262947 |
| Molecular Formula | C29H30ClFN8O5 |
| Molecular Weight | 625.06 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 2-methoxyethyl N-[(10R,14S)-14-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](NC(=O)c1cn(-c3cccc(Cl)c3F)nn1)c1ncc-2[nH]1 |
| InChI | InChI=1S/C29H30ClFN8O5/c1-16-5-3-7-20(35-28(41)23-15-39(38-37-23)24-8-4-6-19(30)25(24)31)26-32-14-22(34-26)18-10-9-17(13-21(18)36-27(16)40)33-29(42)44-12-11-43-2/h4,6,8-10,13-16,20H,3,5,7,11-12H2,1-2H3,(H,32,34)(H,33,42)(H,35,41)(H,36,40)/t16-,20+/m1/s1 |
| InChIKey | DTDXOYAANHCLDI-UZLBHIALSA-N |
| XLogP | 4.87 |
| TPSA | 165.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|