C12H18F3NO — CID 71263242
3,5-Ditert-butyl-4-(trifluoromethyl)-1,2-oxazole (PubChem CID 71263242) has the molecular formula C12H18F3NO and a molecular weight of 249.27 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(trifluoromethyl)-1,2-oxazole.
| Compound Name | 3,5-Ditert-butyl-4-(trifluoromethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 71263242 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3,5-ditert-butyl-4-(trifluoromethyl)-1,2-oxazole |
| SMILES | CC(C)(C)C1=C(C(=NO1)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c1-10(2,3)8-7(12(13,14)15)9(17-16-8)11(4,5)6/h1-6H3 |
| InChIKey | MDJVSHMBFAJBEY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 275 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |