C24H24FNO2S — CID 71263439
N-[4,4-bis(2-methylphenyl)but-3-enyl]-4-fluorobenzenesulfonamide (PubChem CID 71263439) has the molecular formula C24H24FNO2S and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[4,4-bis(2-methylphenyl)but-3-enyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4,4-bis(2-methylphenyl)but-3-enyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71263439 |
| Molecular Formula | C24H24FNO2S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4,4-bis(2-methylphenyl)but-3-enyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1ccccc1C(=CCCNS(=O)(=O)c1ccc(F)cc1)c1ccccc1C |
| InChI | InChI=1S/C24H24FNO2S/c1-18-8-3-5-10-22(18)24(23-11-6-4-9-19(23)2)12-7-17-26-29(27,28)21-15-13-20(25)14-16-21/h3-6,8-16,26H,7,17H2,1-2H3 |
| InChIKey | RTYUYPHHRVSYFX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|